About [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate
[1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate (PubChem CID 175117123) has the molecular formula C18H20Cl2N4O3
and a molecular weight of 411.29 g/mol. Its IUPAC name is [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate.
Molecular Properties
| Compound Name | [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate |
| PubChem CID | 175117123 |
| Molecular Formula | C18H20Cl2N4O3 |
| Molecular Weight | 411.29 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate |
| SMILES | Cc1nc(N2CCC(C)(OC(N)=O)CC2)cc(=O)n1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H20Cl2N4O3/c1-11-22-14(23-8-6-18(2,7-9-23)27-17(21)26)10-15(25)24(11)13-5-3-4-12(19)16(13)20/h3-5,10H,6-9H2,1-2H3,(H2,21,26) |
| InChIKey | NIEBMHYUNYASPX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate?
The IUPAC name of [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate (CID 175117123) is [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate.
What is the SMILES notation for [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate?
The canonical SMILES for [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate is Cc1nc(N2CCC(C)(OC(N)=O)CC2)cc(=O)n1-c1cccc(Cl)c1Cl.
What is the InChIKey of [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate?
The InChIKey is NIEBMHYUNYASPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20Cl2N4O3/c1-11-22-14(23-8-6-18(2,7-9-23)27-17(21)26)10-15(25)24(11)13-5-3-4-12(19)16(13)20/h3-5,10H,6-9H2,1-2H3,(H2,21,26).
What are the key properties of [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate?
[1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate has a molecular weight of 411.29 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2,3-dichlorophenyl)-2-methyl-6-oxopyrimidin-4-yl]-4-methylpiperidin-4-yl] carbamate is sourced from PubChem (CID 175117123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).