C35H51N3O4 — CID 175117925
tert-butyl 2-[2-[2-(5,5-dimethyloxan-2-yl)phenyl]-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate (PubChem CID 175117925) has the molecular formula C35H51N3O4 and a molecular weight of 577.81 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-(5,5-dimethyloxan-2-yl)phenyl]-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate.
| Compound Name | tert-butyl 2-[2-[2-(5,5-dimethyloxan-2-yl)phenyl]-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 175117925 |
| Molecular Formula | C35H51N3O4 |
| Molecular Weight | 577.81 g/mol |
| Exact Mass | 577.39 |
| IUPAC Name | tert-butyl 2-[2-[2-(5,5-dimethyloxan-2-yl)phenyl]-3-[4-(5,6,7,8-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetate |
| SMILES | CC1(C)CCC(c2ccccc2C2C(OCCCCc3ccc4c(n3)CCCN4)CCN2CC(=O)OC(C)(C)C)OC1 |
| InChI | InChI=1S/C35H51N3O4/c1-34(2,3)42-32(39)23-38-21-18-31(40-22-9-8-11-25-15-16-28-29(37-25)14-10-20-36-28)33(38)27-13-7-6-12-26(27)30-17-19-35(4,5)24-41-30/h6-7,12-13,15-16,30-31,33,36H,8-11,14,17-24H2,1-5H3 |
| InChIKey | FAIWIMJLSKRXNU-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.81 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|