About N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide
N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide (PubChem CID 175118443) has the molecular formula C8H12N4O2
and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide.
Molecular Properties
| Compound Name | N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide |
| PubChem CID | 175118443 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide |
| SMILES | CCC(=O)N(c1ncncn1)C(C)O |
| InChI | InChI=1S/C8H12N4O2/c1-3-7(14)12(6(2)13)8-10-4-9-5-11-8/h4-6,13H,3H2,1-2H3 |
| InChIKey | AKEMQAKJFBGQBA-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 79.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide?
The IUPAC name of N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide (CID 175118443) is N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide.
What is the SMILES notation for N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide?
The canonical SMILES for N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide is CCC(=O)N(c1ncncn1)C(C)O.
What is the InChIKey of N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide?
The InChIKey is AKEMQAKJFBGQBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4O2/c1-3-7(14)12(6(2)13)8-10-4-9-5-11-8/h4-6,13H,3H2,1-2H3.
What are the key properties of N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide?
N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide has a molecular weight of 196.21 g/mol, XLogP of -0.05, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-hydroxyethyl)-N-(1,3,5-triazin-2-yl)propanamide is sourced from PubChem (CID 175118443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).