About 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin
2-[3,5-bis(trifluoromethyl)phenyl]porphyrin (PubChem CID 175118825) has the molecular formula C28H14F6N4
and a molecular weight of 520.44 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin.
Molecular Properties
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin |
| PubChem CID | 175118825 |
| Molecular Formula | C28H14F6N4 |
| Molecular Weight | 520.44 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin |
| SMILES | FC(F)(F)c1cc(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H14F6N4/c29-27(30,31)16-7-15(8-17(9-16)28(32,33)34)25-13-24-12-22-4-3-20(36-22)10-18-1-2-19(35-18)11-21-5-6-23(37-21)14-26(25)38-24/h1-14H/b18-10-,19-11-,20-10-,21-11-,22-12-,23-14-,24-12-,26-14- |
| InChIKey | NUMLAWCLQVYSIW-UQWKYRLKSA-N |
| XLogP | 7.14 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.44 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin?
The IUPAC name of 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin (CID 175118825) is 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin.
What is the SMILES notation for 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin?
The canonical SMILES for 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin is FC(F)(F)c1cc(C2=CC3=N/C2=C\C2=N/C(=C\C4=N/C(=C\C5=N/C(=C\3)C=C5)C=C4)C=C2)cc(C(F)(F)F)c1.
What is the InChIKey of 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin?
The InChIKey is NUMLAWCLQVYSIW-UQWKYRLKSA-N. The full InChI is InChI=1S/C28H14F6N4/c29-27(30,31)16-7-15(8-17(9-16)28(32,33)34)25-13-24-12-22-4-3-20(36-22)10-18-1-2-19(35-18)11-21-5-6-23(37-21)14-26(25)38-24/h1-14H/b18-10-,19-11-,20-10-,21-11-,22-12-,23-14-,24-12-,26-14-.
What are the key properties of 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin?
2-[3,5-bis(trifluoromethyl)phenyl]porphyrin has a molecular weight of 520.44 g/mol, XLogP of 7.14, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,5-bis(trifluoromethyl)phenyl]porphyrin is sourced from PubChem (CID 175118825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).