About 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid
7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (PubChem CID 175119806) has the molecular formula C19H13ClN2O2
and a molecular weight of 336.78 g/mol. Its IUPAC name is 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| PubChem CID | 175119806 |
| Molecular Formula | C19H13ClN2O2 |
| Molecular Weight | 336.78 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid |
| SMILES | Cc1c(C(=O)O)nc(-c2ccccc2)c2[nH]c3cc(Cl)ccc3c12 |
| InChI | InChI=1S/C19H13ClN2O2/c1-10-15-13-8-7-12(20)9-14(13)21-18(15)17(22-16(10)19(23)24)11-5-3-2-4-6-11/h2-9,21H,1H3,(H,23,24) |
| InChIKey | CRRZKCCKGRYLMS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.78 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The IUPAC name of 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid (CID 175119806) is 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid.
What is the SMILES notation for 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The canonical SMILES for 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is Cc1c(C(=O)O)nc(-c2ccccc2)c2[nH]c3cc(Cl)ccc3c12.
What is the InChIKey of 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
The InChIKey is CRRZKCCKGRYLMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClN2O2/c1-10-15-13-8-7-12(20)9-14(13)21-18(15)17(22-16(10)19(23)24)11-5-3-2-4-6-11/h2-9,21H,1H3,(H,23,24).
What are the key properties of 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid?
7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid has a molecular weight of 336.78 g/mol, XLogP of 5.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-methyl-1-phenyl-9H-pyrido[3,4-b]indole-3-carboxylic acid is sourced from PubChem (CID 175119806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).