About sodium;octane;silicic acid
sodium;octane;silicic acid (PubChem CID 175120036) has the molecular formula C8H21NaO4Si
and a molecular weight of 232.33 g/mol. Its IUPAC name is sodium;octane;silicic acid.
Molecular Properties
| Compound Name | sodium;octane;silicic acid |
| PubChem CID | 175120036 |
| Molecular Formula | C8H21NaO4Si |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | sodium;octane;silicic acid |
| SMILES | O[Si](O)(O)O.[CH2-]CCCCCCC.[Na+] |
| InChI | InChI=1S/C8H17.Na.H4O4Si/c1-3-5-7-8-6-4-2;;1-5(2,3)4/h1,3-8H2,2H3;;1-4H/q-1;+1; |
| InChIKey | SFZKJLXUEKYSIQ-UHFFFAOYSA-N |
| XLogP | -2.42 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze sodium;octane;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;octane;silicic acid?
The IUPAC name of sodium;octane;silicic acid (CID 175120036) is sodium;octane;silicic acid.
What is the SMILES notation for sodium;octane;silicic acid?
The canonical SMILES for sodium;octane;silicic acid is O[Si](O)(O)O.[CH2-]CCCCCCC.[Na+].
What is the InChIKey of sodium;octane;silicic acid?
The InChIKey is SFZKJLXUEKYSIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17.Na.H4O4Si/c1-3-5-7-8-6-4-2;;1-5(2,3)4/h1,3-8H2,2H3;;1-4H/q-1;+1;.
What are the key properties of sodium;octane;silicic acid?
sodium;octane;silicic acid has a molecular weight of 232.33 g/mol, XLogP of -2.42, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;octane;silicic acid is sourced from PubChem (CID 175120036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).