C32H41N7 — CID 175120225
4-N-(4-anilinophenyl)-6-N-(4-propan-2-ylphenyl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 175120225) has the molecular formula C32H41N7 and a molecular weight of 523.73 g/mol. Its IUPAC name is 4-N-(4-anilinophenyl)-6-N-(4-propan-2-ylphenyl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(4-anilinophenyl)-6-N-(4-propan-2-ylphenyl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 175120225 |
| Molecular Formula | C32H41N7 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | 4-N-(4-anilinophenyl)-6-N-(4-propan-2-ylphenyl)-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)c1ccc(Nc2nc(Nc3ccc(Nc4ccccc4)cc3)nc(NC(C)(C)CC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C32H41N7/c1-22(2)23-13-15-26(16-14-23)34-28-36-29(38-30(37-28)39-32(6,7)21-31(3,4)5)35-27-19-17-25(18-20-27)33-24-11-9-8-10-12-24/h8-20,22,33H,21H2,1-7H3,(H3,34,35,36,37,38,39) |
| InChIKey | ZRBOTEVBRZIVBH-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |