C14H17N — CID 175120340
1,1-dimethyl-2,3,4,6-tetrahydrocarbazole (PubChem CID 175120340) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is 1,1-dimethyl-2,3,4,6-tetrahydrocarbazole.
| Compound Name | 1,1-dimethyl-2,3,4,6-tetrahydrocarbazole |
|---|---|
| PubChem CID | 175120340 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 1,1-dimethyl-2,3,4,6-tetrahydrocarbazole |
| SMILES | CC1(C)CCCC2=C1N=C1C=CCC=C12 |
| InChI | InChI=1S/C14H17N/c1-14(2)9-5-7-11-10-6-3-4-8-12(10)15-13(11)14/h4,6,8H,3,5,7,9H2,1-2H3 |
| InChIKey | UISCQJMEWBFPAD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |