C19H25BFN3O5S — CID 175120406
N-ethyl-2-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine-4-sulfonamide (PubChem CID 175120406) has the molecular formula C19H25BFN3O5S and a molecular weight of 437.30 g/mol. Its IUPAC name is N-ethyl-2-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine-4-sulfonamide.
| Compound Name | N-ethyl-2-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 175120406 |
| Molecular Formula | C19H25BFN3O5S |
| Molecular Weight | 437.30 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-ethyl-2-fluoro-N-[3-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]pyridine-4-sulfonamide |
| SMILES | CCN(c1nc(B2OC(C)(C)C(C)(C)O2)ccc1OC)S(=O)(=O)c1ccnc(F)c1 |
| InChI | InChI=1S/C19H25BFN3O5S/c1-7-24(30(25,26)13-10-11-22-16(21)12-13)17-14(27-6)8-9-15(23-17)20-28-18(2,3)19(4,5)29-20/h8-12H,7H2,1-6H3 |
| InChIKey | PRLABVSZVXQZHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.30 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|