About 1,6-dichlorohex-3-ene-2,5-diamine
1,6-dichlorohex-3-ene-2,5-diamine (PubChem CID 175120445) has the molecular formula C6H12Cl2N2
and a molecular weight of 183.08 g/mol. Its IUPAC name is 1,6-dichlorohex-3-ene-2,5-diamine.
Molecular Properties
| Compound Name | 1,6-dichlorohex-3-ene-2,5-diamine |
| PubChem CID | 175120445 |
| Molecular Formula | C6H12Cl2N2 |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1,6-dichlorohex-3-ene-2,5-diamine |
| SMILES | NC(C=CC(N)CCl)CCl |
| InChI | InChI=1S/C6H12Cl2N2/c7-3-5(9)1-2-6(10)4-8/h1-2,5-6H,3-4,9-10H2 |
| InChIKey | IGASXCILQNIEBM-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dichlorohex-3-ene-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dichlorohex-3-ene-2,5-diamine?
The IUPAC name of 1,6-dichlorohex-3-ene-2,5-diamine (CID 175120445) is 1,6-dichlorohex-3-ene-2,5-diamine.
What is the SMILES notation for 1,6-dichlorohex-3-ene-2,5-diamine?
The canonical SMILES for 1,6-dichlorohex-3-ene-2,5-diamine is NC(C=CC(N)CCl)CCl.
What is the InChIKey of 1,6-dichlorohex-3-ene-2,5-diamine?
The InChIKey is IGASXCILQNIEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12Cl2N2/c7-3-5(9)1-2-6(10)4-8/h1-2,5-6H,3-4,9-10H2.
What are the key properties of 1,6-dichlorohex-3-ene-2,5-diamine?
1,6-dichlorohex-3-ene-2,5-diamine has a molecular weight of 183.08 g/mol, XLogP of 0.67, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dichlorohex-3-ene-2,5-diamine is sourced from PubChem (CID 175120445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).