C25H18Cl2N2O — CID 175120722
6-chloro-3-[1-(3-chlorophenyl)buta-1,3-dien-2-yl]-2-pyridin-2-yl-1H-isoquinoline-1-carbaldehyde (PubChem CID 175120722) has the molecular formula C25H18Cl2N2O and a molecular weight of 433.34 g/mol. Its IUPAC name is 6-chloro-3-[1-(3-chlorophenyl)buta-1,3-dien-2-yl]-2-pyridin-2-yl-1H-isoquinoline-1-carbaldehyde.
| Compound Name | 6-chloro-3-[1-(3-chlorophenyl)buta-1,3-dien-2-yl]-2-pyridin-2-yl-1H-isoquinoline-1-carbaldehyde |
|---|---|
| PubChem CID | 175120722 |
| Molecular Formula | C25H18Cl2N2O |
| Molecular Weight | 433.34 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 6-chloro-3-[1-(3-chlorophenyl)buta-1,3-dien-2-yl]-2-pyridin-2-yl-1H-isoquinoline-1-carbaldehyde |
| SMILES | C=CC(=Cc1cccc(Cl)c1)C1=Cc2cc(Cl)ccc2C(C=O)N1c1ccccn1 |
| InChI | InChI=1S/C25H18Cl2N2O/c1-2-18(12-17-6-5-7-20(26)13-17)23-15-19-14-21(27)9-10-22(19)24(16-30)29(23)25-8-3-4-11-28-25/h2-16,24H,1H2 |
| InChIKey | CCJIUOWPUJNTSO-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|