C21H21N3O6S — CID 175121576
methyl (2E)-2-methoxyimino-2-[3-[[5-[(4-methoxyphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]phenyl]acetate (PubChem CID 175121576) has the molecular formula C21H21N3O6S and a molecular weight of 443.48 g/mol. Its IUPAC name is methyl (2E)-2-methoxyimino-2-[3-[[5-[(4-methoxyphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]phenyl]acetate.
| Compound Name | methyl (2E)-2-methoxyimino-2-[3-[[5-[(4-methoxyphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]phenyl]acetate |
|---|---|
| PubChem CID | 175121576 |
| Molecular Formula | C21H21N3O6S |
| Molecular Weight | 443.48 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | methyl (2E)-2-methoxyimino-2-[3-[[5-[(4-methoxyphenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanylmethyl]phenyl]acetate |
| SMILES | CO/N=C(/C(=O)OC)c1cccc(CSc2nnc(COc3ccc(OC)cc3)o2)c1 |
| InChI | InChI=1S/C21H21N3O6S/c1-26-16-7-9-17(10-8-16)29-12-18-22-23-21(30-18)31-13-14-5-4-6-15(11-14)19(24-28-3)20(25)27-2/h4-11H,12-13H2,1-3H3/b24-19+ |
| InChIKey | BRCAIQHJDXDGQS-LYBHJNIJSA-N |
| XLogP | 3.47 |
| TPSA | 105.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.48 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|