About platinum;tris(ethenyl)phosphane
platinum;tris(ethenyl)phosphane (PubChem CID 175121708) has the molecular formula C6H9PPt
and a molecular weight of 307.19 g/mol. Its IUPAC name is platinum;tris(ethenyl)phosphane.
Molecular Properties
| Compound Name | platinum;tris(ethenyl)phosphane |
| PubChem CID | 175121708 |
| Molecular Formula | C6H9PPt |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | platinum;tris(ethenyl)phosphane |
| SMILES | C=CP(C=C)C=C.[Pt] |
| InChI | InChI=1S/C6H9P.Pt/c1-4-7(5-2)6-3;/h4-6H,1-3H2; |
| InChIKey | IBXIRNPHADSVAQ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze platinum;tris(ethenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;tris(ethenyl)phosphane?
The IUPAC name of platinum;tris(ethenyl)phosphane (CID 175121708) is platinum;tris(ethenyl)phosphane.
What is the SMILES notation for platinum;tris(ethenyl)phosphane?
The canonical SMILES for platinum;tris(ethenyl)phosphane is C=CP(C=C)C=C.[Pt].
What is the InChIKey of platinum;tris(ethenyl)phosphane?
The InChIKey is IBXIRNPHADSVAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9P.Pt/c1-4-7(5-2)6-3;/h4-6H,1-3H2;.
What are the key properties of platinum;tris(ethenyl)phosphane?
platinum;tris(ethenyl)phosphane has a molecular weight of 307.19 g/mol, XLogP of 2.90, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;tris(ethenyl)phosphane is sourced from PubChem (CID 175121708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).