About 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine
7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine (PubChem CID 175122061) has the molecular formula C8H7ClFN3
and a molecular weight of 199.62 g/mol. Its IUPAC name is 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine.
Molecular Properties
| Compound Name | 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine |
| PubChem CID | 175122061 |
| Molecular Formula | C8H7ClFN3 |
| Molecular Weight | 199.62 g/mol |
| Exact Mass | 199.03 |
| IUPAC Name | 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine |
| SMILES | CNc1ncn2cc(F)c(Cl)cc12 |
| InChI | InChI=1S/C8H7ClFN3/c1-11-8-7-2-5(9)6(10)3-13(7)4-12-8/h2-4,11H,1H3 |
| InChIKey | HMXCTPPNJANUPK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.62 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine?
The IUPAC name of 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine (CID 175122061) is 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine.
What is the SMILES notation for 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine?
The canonical SMILES for 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine is CNc1ncn2cc(F)c(Cl)cc12.
What is the InChIKey of 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine?
The InChIKey is HMXCTPPNJANUPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClFN3/c1-11-8-7-2-5(9)6(10)3-13(7)4-12-8/h2-4,11H,1H3.
What are the key properties of 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine?
7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine has a molecular weight of 199.62 g/mol, XLogP of 2.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-6-fluoro-N-methylimidazo[1,5-a]pyridin-1-amine is sourced from PubChem (CID 175122061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).