C21H18F4N6O3 — CID 175122512
(3S,5S)-3-[[4-[2-(4-amino-2,3,5-trifluorophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid (PubChem CID 175122512) has the molecular formula C21H18F4N6O3 and a molecular weight of 478.41 g/mol. Its IUPAC name is (3S,5S)-3-[[4-[2-(4-amino-2,3,5-trifluorophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid.
| Compound Name | (3S,5S)-3-[[4-[2-(4-amino-2,3,5-trifluorophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175122512 |
| Molecular Formula | C21H18F4N6O3 |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.14 |
| IUPAC Name | (3S,5S)-3-[[4-[2-(4-amino-2,3,5-trifluorophenoxy)-3-pyridinyl]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylic acid |
| SMILES | Nc1c(F)cc(Oc2ncccc2-c2ccnc(N[C@H]3C[C@H](F)CN(C(=O)O)C3)n2)c(F)c1F |
| InChI | InChI=1S/C21H18F4N6O3/c22-10-6-11(9-31(8-10)21(32)33)29-20-28-5-3-14(30-20)12-2-1-4-27-19(12)34-15-7-13(23)18(26)17(25)16(15)24/h1-5,7,10-11H,6,8-9,26H2,(H,32,33)(H,28,29,30)/t10-,11-/m0/s1 |
| InChIKey | UEBKREQQGFTSMD-QWRGUYRKSA-N |
| XLogP | 3.83 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|