C28H29N5O3 — CID 175122999
N-(4-morpholin-2-ylphenyl)-3-(6-morpholin-2-yl-3-pyridinyl)-1H-indole-6-carboxamide (PubChem CID 175122999) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-(4-morpholin-2-ylphenyl)-3-(6-morpholin-2-yl-3-pyridinyl)-1H-indole-6-carboxamide.
| Compound Name | N-(4-morpholin-2-ylphenyl)-3-(6-morpholin-2-yl-3-pyridinyl)-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 175122999 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-(4-morpholin-2-ylphenyl)-3-(6-morpholin-2-yl-3-pyridinyl)-1H-indole-6-carboxamide |
| SMILES | O=C(Nc1ccc(C2CNCCO2)cc1)c1ccc2c(-c3ccc(C4CNCCO4)nc3)c[nH]c2c1 |
| InChI | InChI=1S/C28H29N5O3/c34-28(33-21-5-1-18(2-6-21)26-16-29-9-11-35-26)19-3-7-22-23(15-32-25(22)13-19)20-4-8-24(31-14-20)27-17-30-10-12-36-27/h1-8,13-15,26-27,29-30,32H,9-12,16-17H2,(H,33,34) |
| InChIKey | WUFDLVIXXJVZBJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |