About methylimino(oxo)methane;propane-1,2,3-triol
methylimino(oxo)methane;propane-1,2,3-triol (PubChem CID 175123227) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is methylimino(oxo)methane;propane-1,2,3-triol.
Molecular Properties
| Compound Name | methylimino(oxo)methane;propane-1,2,3-triol |
| PubChem CID | 175123227 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | methylimino(oxo)methane;propane-1,2,3-triol |
| SMILES | CN=C=O.OCC(O)CO |
| InChI | InChI=1S/C3H8O3.C2H3NO/c4-1-3(6)2-5;1-3-2-4/h3-6H,1-2H2;1H3 |
| InChIKey | RNFHKIFXNIZMLD-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze methylimino(oxo)methane;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylimino(oxo)methane;propane-1,2,3-triol?
The IUPAC name of methylimino(oxo)methane;propane-1,2,3-triol (CID 175123227) is methylimino(oxo)methane;propane-1,2,3-triol.
What is the SMILES notation for methylimino(oxo)methane;propane-1,2,3-triol?
The canonical SMILES for methylimino(oxo)methane;propane-1,2,3-triol is CN=C=O.OCC(O)CO.
What is the InChIKey of methylimino(oxo)methane;propane-1,2,3-triol?
The InChIKey is RNFHKIFXNIZMLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O3.C2H3NO/c4-1-3(6)2-5;1-3-2-4/h3-6H,1-2H2;1H3.
What are the key properties of methylimino(oxo)methane;propane-1,2,3-triol?
methylimino(oxo)methane;propane-1,2,3-triol has a molecular weight of 149.15 g/mol, XLogP of -1.72, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methylimino(oxo)methane;propane-1,2,3-triol is sourced from PubChem (CID 175123227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).