C10H14N2O3 — CID 175123275
3-(1,3,3a,4,5,6-hexahydropyrrolo[3,4-c]pyridin-2-yl)-3-oxopropanoic acid (PubChem CID 175123275) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-(1,3,3a,4,5,6-hexahydropyrrolo[3,4-c]pyridin-2-yl)-3-oxopropanoic acid.
| Compound Name | 3-(1,3,3a,4,5,6-hexahydropyrrolo[3,4-c]pyridin-2-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 175123275 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-(1,3,3a,4,5,6-hexahydropyrrolo[3,4-c]pyridin-2-yl)-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)N1CC2=CCNCC2C1 |
| InChI | InChI=1S/C10H14N2O3/c13-9(3-10(14)15)12-5-7-1-2-11-4-8(7)6-12/h1,8,11H,2-6H2,(H,14,15) |
| InChIKey | NITIQWREMHDQHZ-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|