About cyclopropane;trimethylsilane
cyclopropane;trimethylsilane (PubChem CID 175124572) has the molecular formula C6H16Si
and a molecular weight of 116.28 g/mol. Its IUPAC name is cyclopropane;trimethylsilane.
Molecular Properties
| Compound Name | cyclopropane;trimethylsilane |
| PubChem CID | 175124572 |
| Molecular Formula | C6H16Si |
| Molecular Weight | 116.28 g/mol |
| Exact Mass | 116.10 |
| IUPAC Name | cyclopropane;trimethylsilane |
| SMILES | C1CC1.C[SiH](C)C |
| InChI | InChI=1S/C3H10Si.C3H6/c1-4(2)3;1-2-3-1/h4H,1-3H3;1-3H2 |
| InChIKey | MFMLTLVAJYPIDP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopropane;trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;trimethylsilane?
The IUPAC name of cyclopropane;trimethylsilane (CID 175124572) is cyclopropane;trimethylsilane.
What is the SMILES notation for cyclopropane;trimethylsilane?
The canonical SMILES for cyclopropane;trimethylsilane is C1CC1.C[SiH](C)C.
What is the InChIKey of cyclopropane;trimethylsilane?
The InChIKey is MFMLTLVAJYPIDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10Si.C3H6/c1-4(2)3;1-2-3-1/h4H,1-3H3;1-3H2.
What are the key properties of cyclopropane;trimethylsilane?
cyclopropane;trimethylsilane has a molecular weight of 116.28 g/mol, XLogP of 2.27, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;trimethylsilane is sourced from PubChem (CID 175124572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).