About sodium 3,3,3-trihydroxypropane-1-sulfonate
sodium 3,3,3-trihydroxypropane-1-sulfonate (PubChem CID 175125051) has the molecular formula C3H7NaO6S
and a molecular weight of 194.14 g/mol. Its IUPAC name is sodium 3,3,3-trihydroxypropane-1-sulfonate.
Molecular Properties
| Compound Name | sodium 3,3,3-trihydroxypropane-1-sulfonate |
| PubChem CID | 175125051 |
| Molecular Formula | C3H7NaO6S |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 193.99 |
| IUPAC Name | sodium 3,3,3-trihydroxypropane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCC(O)(O)O.[Na+] |
| InChI | InChI=1S/C3H8O6S.Na/c4-3(5,6)1-2-10(7,8)9;/h4-6H,1-2H2,(H,7,8,9);/q;+1/p-1 |
| InChIKey | XFDRFNNTVCHILG-UHFFFAOYSA-M |
| XLogP | -5.44 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | -5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium 3,3,3-trihydroxypropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 3,3,3-trihydroxypropane-1-sulfonate?
The IUPAC name of sodium 3,3,3-trihydroxypropane-1-sulfonate (CID 175125051) is sodium 3,3,3-trihydroxypropane-1-sulfonate.
What is the SMILES notation for sodium 3,3,3-trihydroxypropane-1-sulfonate?
The canonical SMILES for sodium 3,3,3-trihydroxypropane-1-sulfonate is O=S(=O)([O-])CCC(O)(O)O.[Na+].
What is the InChIKey of sodium 3,3,3-trihydroxypropane-1-sulfonate?
The InChIKey is XFDRFNNTVCHILG-UHFFFAOYSA-M. The full InChI is InChI=1S/C3H8O6S.Na/c4-3(5,6)1-2-10(7,8)9;/h4-6H,1-2H2,(H,7,8,9);/q;+1/p-1.
What are the key properties of sodium 3,3,3-trihydroxypropane-1-sulfonate?
sodium 3,3,3-trihydroxypropane-1-sulfonate has a molecular weight of 194.14 g/mol, XLogP of -5.44, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3,3,3-trihydroxypropane-1-sulfonate is sourced from PubChem (CID 175125051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).