About 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine
1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine (PubChem CID 175125519) has the molecular formula C6H8N4
and a molecular weight of 136.16 g/mol. Its IUPAC name is 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine.
Molecular Properties
| Compound Name | 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine |
| PubChem CID | 175125519 |
| Molecular Formula | C6H8N4 |
| Molecular Weight | 136.16 g/mol |
| Exact Mass | 136.07 |
| IUPAC Name | 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine |
| SMILES | NC1=CC2=CN=CCN2N1 |
| InChI | InChI=1S/C6H8N4/c7-6-3-5-4-8-1-2-10(5)9-6/h1,3-4,9H,2,7H2 |
| InChIKey | HQWXPBVQLXUBFC-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine?
The IUPAC name of 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine (CID 175125519) is 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine.
What is the SMILES notation for 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine?
The canonical SMILES for 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine is NC1=CC2=CN=CCN2N1.
What is the InChIKey of 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine?
The InChIKey is HQWXPBVQLXUBFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4/c7-6-3-5-4-8-1-2-10(5)9-6/h1,3-4,9H,2,7H2.
What are the key properties of 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine?
1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine has a molecular weight of 136.16 g/mol, XLogP of -0.47, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dihydropyrazolo[1,5-a]pyrazin-2-amine is sourced from PubChem (CID 175125519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).