C11H12I2N2O4 — CID 175125676
5-(2,3-dihydroxypropyl)-2,4-diiodobenzene-1,3-dicarboxamide (PubChem CID 175125676) has the molecular formula C11H12I2N2O4 and a molecular weight of 490.04 g/mol. Its IUPAC name is 5-(2,3-dihydroxypropyl)-2,4-diiodobenzene-1,3-dicarboxamide.
| Compound Name | 5-(2,3-dihydroxypropyl)-2,4-diiodobenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 175125676 |
| Molecular Formula | C11H12I2N2O4 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.89 |
| IUPAC Name | 5-(2,3-dihydroxypropyl)-2,4-diiodobenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cc(CC(O)CO)c(I)c(C(N)=O)c1I |
| InChI | InChI=1S/C11H12I2N2O4/c12-8-4(1-5(17)3-16)2-6(10(14)18)9(13)7(8)11(15)19/h2,5,16-17H,1,3H2,(H2,14,18)(H2,15,19) |
| InChIKey | OSCOYUADWFFNIY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|