About 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide
5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide (PubChem CID 175125862) has the molecular formula C18H22BrN3O
and a molecular weight of 376.30 g/mol. Its IUPAC name is 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide.
Molecular Properties
| Compound Name | 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide |
| PubChem CID | 175125862 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(/c1cc(Br)c(OCCc2ccccc2)nc1C)N(C)CC |
| InChI | InChI=1S/C18H22BrN3O/c1-4-22(3)17(20)15-12-16(19)18(21-13(15)2)23-11-10-14-8-6-5-7-9-14/h5-9,12,20H,4,10-11H2,1-3H3/b20-17- |
| InChIKey | YKYZORFPODNYHY-JZJYNLBNSA-N |
| XLogP | 4.05 |
| TPSA | 49.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide?
The IUPAC name of 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide (CID 175125862) is 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide.
What is the SMILES notation for 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide?
The canonical SMILES for 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide is [H]/N=C(/c1cc(Br)c(OCCc2ccccc2)nc1C)N(C)CC.
What is the InChIKey of 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide?
The InChIKey is YKYZORFPODNYHY-JZJYNLBNSA-N. The full InChI is InChI=1S/C18H22BrN3O/c1-4-22(3)17(20)15-12-16(19)18(21-13(15)2)23-11-10-14-8-6-5-7-9-14/h5-9,12,20H,4,10-11H2,1-3H3/b20-17-.
What are the key properties of 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide?
5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide has a molecular weight of 376.30 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-ethyl-N,2-dimethyl-6-(2-phenylethoxy)pyridine-3-carboximidamide is sourced from PubChem (CID 175125862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).