About (8-nonoxy-8-oxooctyl) 2-aminooctanoate
(8-nonoxy-8-oxooctyl) 2-aminooctanoate (PubChem CID 175126875) has the molecular formula C25H49NO4
and a molecular weight of 427.67 g/mol. Its IUPAC name is (8-nonoxy-8-oxooctyl) 2-aminooctanoate.
Molecular Properties
| Compound Name | (8-nonoxy-8-oxooctyl) 2-aminooctanoate |
| PubChem CID | 175126875 |
| Molecular Formula | C25H49NO4 |
| Molecular Weight | 427.67 g/mol |
| Exact Mass | 427.37 |
| IUPAC Name | (8-nonoxy-8-oxooctyl) 2-aminooctanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCOC(=O)C(N)CCCCCC |
| InChI | InChI=1S/C25H49NO4/c1-3-5-7-9-10-13-17-21-29-24(27)20-16-12-11-14-18-22-30-25(28)23(26)19-15-8-6-4-2/h23H,3-22,26H2,1-2H3 |
| InChIKey | MLMYNWKUABOUKY-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.67 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (8-nonoxy-8-oxooctyl) 2-aminooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-nonoxy-8-oxooctyl) 2-aminooctanoate?
The IUPAC name of (8-nonoxy-8-oxooctyl) 2-aminooctanoate (CID 175126875) is (8-nonoxy-8-oxooctyl) 2-aminooctanoate.
What is the SMILES notation for (8-nonoxy-8-oxooctyl) 2-aminooctanoate?
The canonical SMILES for (8-nonoxy-8-oxooctyl) 2-aminooctanoate is CCCCCCCCCOC(=O)CCCCCCCOC(=O)C(N)CCCCCC.
What is the InChIKey of (8-nonoxy-8-oxooctyl) 2-aminooctanoate?
The InChIKey is MLMYNWKUABOUKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H49NO4/c1-3-5-7-9-10-13-17-21-29-24(27)20-16-12-11-14-18-22-30-25(28)23(26)19-15-8-6-4-2/h23H,3-22,26H2,1-2H3.
What are the key properties of (8-nonoxy-8-oxooctyl) 2-aminooctanoate?
(8-nonoxy-8-oxooctyl) 2-aminooctanoate has a molecular weight of 427.67 g/mol, XLogP of 6.46, 22 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (8-nonoxy-8-oxooctyl) 2-aminooctanoate is sourced from PubChem (CID 175126875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).