About 2,3-difluoro-2H-pyran
2,3-difluoro-2H-pyran (PubChem CID 175126929) has the molecular formula C5H4F2O
and a molecular weight of 118.08 g/mol. Its IUPAC name is 2,3-difluoro-2H-pyran.
Molecular Properties
| Compound Name | 2,3-difluoro-2H-pyran |
| PubChem CID | 175126929 |
| Molecular Formula | C5H4F2O |
| Molecular Weight | 118.08 g/mol |
| Exact Mass | 118.02 |
| IUPAC Name | 2,3-difluoro-2H-pyran |
| SMILES | FC1=CC=COC1F |
| InChI | InChI=1S/C5H4F2O/c6-4-2-1-3-8-5(4)7/h1-3,5H |
| InChIKey | HHKNSVHSOGBSMH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-difluoro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-difluoro-2H-pyran?
The IUPAC name of 2,3-difluoro-2H-pyran (CID 175126929) is 2,3-difluoro-2H-pyran.
What is the SMILES notation for 2,3-difluoro-2H-pyran?
The canonical SMILES for 2,3-difluoro-2H-pyran is FC1=CC=COC1F.
What is the InChIKey of 2,3-difluoro-2H-pyran?
The InChIKey is HHKNSVHSOGBSMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F2O/c6-4-2-1-3-8-5(4)7/h1-3,5H.
What are the key properties of 2,3-difluoro-2H-pyran?
2,3-difluoro-2H-pyran has a molecular weight of 118.08 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-difluoro-2H-pyran is sourced from PubChem (CID 175126929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).