About 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron
1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron (PubChem CID 175128292) has the molecular formula C18H15FeNO-6
and a molecular weight of 317.17 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron.
Molecular Properties
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron |
| PubChem CID | 175128292 |
| Molecular Formula | C18H15FeNO-6 |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron |
| SMILES | O=C(C=Cc1ccccn1)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C13H10NO.C5H5.Fe/c15-13(11-5-1-2-6-11)9-8-12-7-3-4-10-14-12;1-2-4-5-3-1;/h1-10H;1-5H;/q-1;-5; |
| InChIKey | CZECGSFTQWVLBZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron?
The IUPAC name of 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron (CID 175128292) is 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron.
What is the SMILES notation for 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron?
The canonical SMILES for 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron is O=C(C=Cc1ccccn1)[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1.
What is the InChIKey of 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron?
The InChIKey is CZECGSFTQWVLBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10NO.C5H5.Fe/c15-13(11-5-1-2-6-11)9-8-12-7-3-4-10-14-12;1-2-4-5-3-1;/h1-10H;1-5H;/q-1;-5;.
What are the key properties of 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron?
1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron has a molecular weight of 317.17 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopenta-2,4-dien-1-yl-3-pyridin-2-ylprop-2-en-1-one;cyclopentane;iron is sourced from PubChem (CID 175128292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).