About furan-2-carboxamide;9H-pyrido[3,4-b]indole
furan-2-carboxamide;9H-pyrido[3,4-b]indole (PubChem CID 175128472) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is furan-2-carboxamide;9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | furan-2-carboxamide;9H-pyrido[3,4-b]indole |
| PubChem CID | 175128472 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | furan-2-carboxamide;9H-pyrido[3,4-b]indole |
| SMILES | NC(=O)c1ccco1.c1ccc2c(c1)[nH]c1cnccc12 |
| InChI | InChI=1S/C11H8N2.C5H5NO2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;6-5(7)4-2-1-3-8-4/h1-7,13H;1-3H,(H2,6,7) |
| InChIKey | SSZPLPYKYKXNAP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze furan-2-carboxamide;9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of furan-2-carboxamide;9H-pyrido[3,4-b]indole?
The IUPAC name of furan-2-carboxamide;9H-pyrido[3,4-b]indole (CID 175128472) is furan-2-carboxamide;9H-pyrido[3,4-b]indole.
What is the SMILES notation for furan-2-carboxamide;9H-pyrido[3,4-b]indole?
The canonical SMILES for furan-2-carboxamide;9H-pyrido[3,4-b]indole is NC(=O)c1ccco1.c1ccc2c(c1)[nH]c1cnccc12.
What is the InChIKey of furan-2-carboxamide;9H-pyrido[3,4-b]indole?
The InChIKey is SSZPLPYKYKXNAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.C5H5NO2/c1-2-4-10-8(3-1)9-5-6-12-7-11(9)13-10;6-5(7)4-2-1-3-8-4/h1-7,13H;1-3H,(H2,6,7).
What are the key properties of furan-2-carboxamide;9H-pyrido[3,4-b]indole?
furan-2-carboxamide;9H-pyrido[3,4-b]indole has a molecular weight of 279.30 g/mol, XLogP of 3.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for furan-2-carboxamide;9H-pyrido[3,4-b]indole is sourced from PubChem (CID 175128472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).