About 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde
2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde (PubChem CID 175128508) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde.
Molecular Properties
| Compound Name | 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde |
| PubChem CID | 175128508 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde |
| SMILES | CC(C)(C)OC1CCOC(C)(C=O)O1 |
| InChI | InChI=1S/C10H18O4/c1-9(2,3)13-8-5-6-12-10(4,7-11)14-8/h7-8H,5-6H2,1-4H3 |
| InChIKey | IFBJHSAAHRBBDT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde?
The IUPAC name of 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde (CID 175128508) is 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde.
What is the SMILES notation for 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde?
The canonical SMILES for 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde is CC(C)(C)OC1CCOC(C)(C=O)O1.
What is the InChIKey of 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde?
The InChIKey is IFBJHSAAHRBBDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-9(2,3)13-8-5-6-12-10(4,7-11)14-8/h7-8H,5-6H2,1-4H3.
What are the key properties of 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde?
2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde has a molecular weight of 202.25 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-[(2-methylpropan-2-yl)oxy]-1,3-dioxane-2-carbaldehyde is sourced from PubChem (CID 175128508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).