C20H21F3N6O2 — CID 175129143
2-[[2-[[5-methyl-1-(oxan-4-yl)pyrazol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenol (PubChem CID 175129143) has the molecular formula C20H21F3N6O2 and a molecular weight of 434.42 g/mol. Its IUPAC name is 2-[[2-[[5-methyl-1-(oxan-4-yl)pyrazol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenol.
| Compound Name | 2-[[2-[[5-methyl-1-(oxan-4-yl)pyrazol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenol |
|---|---|
| PubChem CID | 175129143 |
| Molecular Formula | C20H21F3N6O2 |
| Molecular Weight | 434.42 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 2-[[2-[[5-methyl-1-(oxan-4-yl)pyrazol-4-yl]amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenol |
| SMILES | Cc1c(Nc2ncc(C(F)(F)F)c(Nc3ccccc3O)n2)cnn1C1CCOCC1 |
| InChI | InChI=1S/C20H21F3N6O2/c1-12-16(11-25-29(12)13-6-8-31-9-7-13)27-19-24-10-14(20(21,22)23)18(28-19)26-15-4-2-3-5-17(15)30/h2-5,10-11,13,30H,6-9H2,1H3,(H2,24,26,27,28) |
| InChIKey | HQYALAHLHBRHLB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|