About cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane
cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane (PubChem CID 175130109) has the molecular formula C16H34OSi
and a molecular weight of 270.53 g/mol. Its IUPAC name is cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane.
Molecular Properties
| Compound Name | cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane |
| PubChem CID | 175130109 |
| Molecular Formula | C16H34OSi |
| Molecular Weight | 270.53 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane |
| SMILES | CC(C)(C)CCCC[Si](C)(C)OC1CCCCC1 |
| InChI | InChI=1S/C16H34OSi/c1-16(2,3)13-9-10-14-18(4,5)17-15-11-7-6-8-12-15/h15H,6-14H2,1-5H3 |
| InChIKey | DABIKICZZFVHKC-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.53 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane?
The IUPAC name of cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane (CID 175130109) is cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane.
What is the SMILES notation for cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane?
The canonical SMILES for cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane is CC(C)(C)CCCC[Si](C)(C)OC1CCCCC1.
What is the InChIKey of cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane?
The InChIKey is DABIKICZZFVHKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34OSi/c1-16(2,3)13-9-10-14-18(4,5)17-15-11-7-6-8-12-15/h15H,6-14H2,1-5H3.
What are the key properties of cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane?
cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane has a molecular weight of 270.53 g/mol, XLogP of 5.76, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxy-(5,5-dimethylhexyl)-dimethylsilane is sourced from PubChem (CID 175130109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).