C19H31N3O5 — CID 175130527
tert-butyl 4-[4-(cyclopropanecarbonyloxy)piperidine-1-carbonyl]piperazine-1-carboxylate (PubChem CID 175130527) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is tert-butyl 4-[4-(cyclopropanecarbonyloxy)piperidine-1-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-(cyclopropanecarbonyloxy)piperidine-1-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 175130527 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl 4-[4-(cyclopropanecarbonyloxy)piperidine-1-carbonyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)N2CCC(OC(=O)C3CC3)CC2)CC1 |
| InChI | InChI=1S/C19H31N3O5/c1-19(2,3)27-18(25)22-12-10-21(11-13-22)17(24)20-8-6-15(7-9-20)26-16(23)14-4-5-14/h14-15H,4-13H2,1-3H3 |
| InChIKey | BLMVJAOLYXNLAY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |