C27H36N4O3 — CID 175130777
2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-(1,2,3,4-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid (PubChem CID 175130777) has the molecular formula C27H36N4O3 and a molecular weight of 464.61 g/mol. Its IUPAC name is 2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-(1,2,3,4-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-(1,2,3,4-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 175130777 |
| Molecular Formula | C27H36N4O3 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | 2-(2-cyclobutyl-3-pyridinyl)-2-[(3R)-3-[4-(1,2,3,4-tetrahydro-1,5-naphthyridin-2-yl)butoxy]pyrrolidin-1-yl]acetic acid |
| SMILES | O=C(O)C(c1cccnc1C1CCC1)N1CC[C@@H](OCCCCC2CCc3ncccc3N2)C1 |
| InChI | InChI=1S/C27H36N4O3/c32-27(33)26(22-9-4-15-29-25(22)19-6-3-7-19)31-16-13-21(18-31)34-17-2-1-8-20-11-12-23-24(30-20)10-5-14-28-23/h4-5,9-10,14-15,19-21,26,30H,1-3,6-8,11-13,16-18H2,(H,32,33)/t20?,21-,26?/m1/s1 |
| InChIKey | XCUKQVRUWDAFGV-QLSBTUPBSA-N |
| XLogP | 4.56 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|