C15H25NO — CID 175130807
2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one (PubChem CID 175130807) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one.
| Compound Name | 2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one |
|---|---|
| PubChem CID | 175130807 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-1,3-bis(prop-2-enyl)piperidin-4-one |
| SMILES | C=CCC1C(=O)CC(C)(C)N(CC=C)C1(C)C |
| InChI | InChI=1S/C15H25NO/c1-7-9-12-13(17)11-14(3,4)16(10-8-2)15(12,5)6/h7-8,12H,1-2,9-11H2,3-6H3 |
| InChIKey | YFAMYJQJZJCGPM-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|