C21H24ClF2N3O4S — CID 175131525
2-[[[2-(3-chloro-4-fluorophenyl)-2-(4-fluoropiperidin-1-yl)ethyl]-sulfinoamino]methyl]-5-methoxycarbonylpyridine (PubChem CID 175131525) has the molecular formula C21H24ClF2N3O4S and a molecular weight of 487.96 g/mol. Its IUPAC name is 2-[[[2-(3-chloro-4-fluorophenyl)-2-(4-fluoropiperidin-1-yl)ethyl]-sulfinoamino]methyl]-5-methoxycarbonylpyridine.
| Compound Name | 2-[[[2-(3-chloro-4-fluorophenyl)-2-(4-fluoropiperidin-1-yl)ethyl]-sulfinoamino]methyl]-5-methoxycarbonylpyridine |
|---|---|
| PubChem CID | 175131525 |
| Molecular Formula | C21H24ClF2N3O4S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | 2-[[[2-(3-chloro-4-fluorophenyl)-2-(4-fluoropiperidin-1-yl)ethyl]-sulfinoamino]methyl]-5-methoxycarbonylpyridine |
| SMILES | COC(=O)c1ccc(CN(CC(c2ccc(F)c(Cl)c2)N2CCC(F)CC2)S(=O)O)nc1 |
| InChI | InChI=1S/C21H24ClF2N3O4S/c1-31-21(28)15-2-4-17(25-11-15)12-27(32(29)30)13-20(26-8-6-16(23)7-9-26)14-3-5-19(24)18(22)10-14/h2-5,10-11,16,20H,6-9,12-13H2,1H3,(H,29,30) |
| InChIKey | CWJXUPDUJDHUOF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|