C25H21N3O5S — CID 175131585
5,7,11-triamino-7-[4-(2-hydroxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid (PubChem CID 175131585) has the molecular formula C25H21N3O5S and a molecular weight of 475.53 g/mol. Its IUPAC name is 5,7,11-triamino-7-[4-(2-hydroxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid.
| Compound Name | 5,7,11-triamino-7-[4-(2-hydroxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
|---|---|
| PubChem CID | 175131585 |
| Molecular Formula | C25H21N3O5S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 5,7,11-triamino-7-[4-(2-hydroxyphenoxy)-2-methylphenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylic acid |
| SMILES | Cc1cc(Oc2ccccc2O)ccc1C1(N)C(=O)C(N)c2c(C(=O)O)sc3c(N)ccc1c23 |
| InChI | InChI=1S/C25H21N3O5S/c1-11-10-12(33-17-5-3-2-4-16(17)29)6-7-13(11)25(28)14-8-9-15(26)21-18(14)19(20(27)23(25)30)22(34-21)24(31)32/h2-10,20,29H,26-28H2,1H3,(H,31,32) |
| InChIKey | SXQBDJRBHMXJRP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 161.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|