About 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide
1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide (PubChem CID 175131587) has the molecular formula C12H23BrN4
and a molecular weight of 303.25 g/mol. Its IUPAC name is 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide.
Molecular Properties
| Compound Name | 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide |
| PubChem CID | 175131587 |
| Molecular Formula | C12H23BrN4 |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide |
| SMILES | Br.CCCCN1C=CN(C)C1C.c1c[nH]cn1 |
| InChI | InChI=1S/C9H18N2.C3H4N2.BrH/c1-4-5-6-11-8-7-10(3)9(11)2;1-2-5-3-4-1;/h7-9H,4-6H2,1-3H3;1-3H,(H,4,5);1H |
| InChIKey | QOUGIINPWAUEIK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide?
The IUPAC name of 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide (CID 175131587) is 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide.
What is the SMILES notation for 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide?
The canonical SMILES for 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide is Br.CCCCN1C=CN(C)C1C.c1c[nH]cn1.
What is the InChIKey of 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide?
The InChIKey is QOUGIINPWAUEIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2.C3H4N2.BrH/c1-4-5-6-11-8-7-10(3)9(11)2;1-2-5-3-4-1;/h7-9H,4-6H2,1-3H3;1-3H,(H,4,5);1H.
What are the key properties of 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide?
1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide has a molecular weight of 303.25 g/mol, XLogP of 2.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2,3-dimethyl-2H-imidazole;1H-imidazole;hydrobromide is sourced from PubChem (CID 175131587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).