About 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane
9,9-dimethylxanthene;(4-ethenylphenyl)phosphane (PubChem CID 175131716) has the molecular formula C23H23OP
and a molecular weight of 346.41 g/mol. Its IUPAC name is 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane.
Molecular Properties
| Compound Name | 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane |
| PubChem CID | 175131716 |
| Molecular Formula | C23H23OP |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane |
| SMILES | C=Cc1ccc(P)cc1.CC1(C)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C15H14O.C8H9P/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;1-2-7-3-5-8(9)6-4-7/h3-10H,1-2H3;2-6H,1,9H2 |
| InChIKey | SPKVWFXHYZUPOU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane?
The IUPAC name of 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane (CID 175131716) is 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane.
What is the SMILES notation for 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane?
The canonical SMILES for 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane is C=Cc1ccc(P)cc1.CC1(C)c2ccccc2Oc2ccccc21.
What is the InChIKey of 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane?
The InChIKey is SPKVWFXHYZUPOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C8H9P/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;1-2-7-3-5-8(9)6-4-7/h3-10H,1-2H3;2-6H,1,9H2.
What are the key properties of 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane?
9,9-dimethylxanthene;(4-ethenylphenyl)phosphane has a molecular weight of 346.41 g/mol, XLogP of 5.95, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylxanthene;(4-ethenylphenyl)phosphane is sourced from PubChem (CID 175131716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).