C23H26FN5O — CID 175132059
3-cyclopentyl-1-[7-[[(1R)-1-(3-fluorophenyl)ethyl]amino]quinazolin-2-yl]-1-methylurea (PubChem CID 175132059) has the molecular formula C23H26FN5O and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-cyclopentyl-1-[7-[[(1R)-1-(3-fluorophenyl)ethyl]amino]quinazolin-2-yl]-1-methylurea.
| Compound Name | 3-cyclopentyl-1-[7-[[(1R)-1-(3-fluorophenyl)ethyl]amino]quinazolin-2-yl]-1-methylurea |
|---|---|
| PubChem CID | 175132059 |
| Molecular Formula | C23H26FN5O |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 3-cyclopentyl-1-[7-[[(1R)-1-(3-fluorophenyl)ethyl]amino]quinazolin-2-yl]-1-methylurea |
| SMILES | C[C@@H](Nc1ccc2cnc(N(C)C(=O)NC3CCCC3)nc2c1)c1cccc(F)c1 |
| InChI | InChI=1S/C23H26FN5O/c1-15(16-6-5-7-18(24)12-16)26-20-11-10-17-14-25-22(28-21(17)13-20)29(2)23(30)27-19-8-3-4-9-19/h5-7,10-15,19,26H,3-4,8-9H2,1-2H3,(H,27,30)/t15-/m1/s1 |
| InChIKey | RMTKIKVPXAJHQQ-OAHLLOKOSA-N |
| XLogP | 5.03 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |