About acetic acid;3,3-difluorocyclobutane-1-thiol
acetic acid;3,3-difluorocyclobutane-1-thiol (PubChem CID 175132258) has the molecular formula C6H10F2O2S
and a molecular weight of 184.21 g/mol. Its IUPAC name is acetic acid;3,3-difluorocyclobutane-1-thiol.
Molecular Properties
| Compound Name | acetic acid;3,3-difluorocyclobutane-1-thiol |
| PubChem CID | 175132258 |
| Molecular Formula | C6H10F2O2S |
| Molecular Weight | 184.21 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | acetic acid;3,3-difluorocyclobutane-1-thiol |
| SMILES | CC(=O)O.FC1(F)CC(S)C1 |
| InChI | InChI=1S/C4H6F2S.C2H4O2/c5-4(6)1-3(7)2-4;1-2(3)4/h3,7H,1-2H2;1H3,(H,3,4) |
| InChIKey | CIJXMPHRBMQLBG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;3,3-difluorocyclobutane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;3,3-difluorocyclobutane-1-thiol?
The IUPAC name of acetic acid;3,3-difluorocyclobutane-1-thiol (CID 175132258) is acetic acid;3,3-difluorocyclobutane-1-thiol.
What is the SMILES notation for acetic acid;3,3-difluorocyclobutane-1-thiol?
The canonical SMILES for acetic acid;3,3-difluorocyclobutane-1-thiol is CC(=O)O.FC1(F)CC(S)C1.
What is the InChIKey of acetic acid;3,3-difluorocyclobutane-1-thiol?
The InChIKey is CIJXMPHRBMQLBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6F2S.C2H4O2/c5-4(6)1-3(7)2-4;1-2(3)4/h3,7H,1-2H2;1H3,(H,3,4).
What are the key properties of acetic acid;3,3-difluorocyclobutane-1-thiol?
acetic acid;3,3-difluorocyclobutane-1-thiol has a molecular weight of 184.21 g/mol, XLogP of 1.80, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;3,3-difluorocyclobutane-1-thiol is sourced from PubChem (CID 175132258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).