C20H28O4 — CID 175132833
3-(2-methylprop-2-enoyloxy)benzoic acid;1,1,3-trimethylcyclohexane (PubChem CID 175132833) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is 3-(2-methylprop-2-enoyloxy)benzoic acid;1,1,3-trimethylcyclohexane.
| Compound Name | 3-(2-methylprop-2-enoyloxy)benzoic acid;1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 175132833 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3-(2-methylprop-2-enoyloxy)benzoic acid;1,1,3-trimethylcyclohexane |
| SMILES | C=C(C)C(=O)Oc1cccc(C(=O)O)c1.CC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C11H10O4.C9H18/c1-7(2)11(14)15-9-5-3-4-8(6-9)10(12)13;1-8-5-4-6-9(2,3)7-8/h3-6H,1H2,2H3,(H,12,13);8H,4-7H2,1-3H3 |
| InChIKey | VHEJAKXOWYNCMG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|