C27H34N2O9 — CID 175133074
[(3R,4R,5R)-2,4-diacetyloxy-4-ethynyl-5-[[2-methyl-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]propan-2-yl]oxymethyl]oxolan-3-yl] acetate (PubChem CID 175133074) has the molecular formula C27H34N2O9 and a molecular weight of 530.57 g/mol. Its IUPAC name is [(3R,4R,5R)-2,4-diacetyloxy-4-ethynyl-5-[[2-methyl-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]propan-2-yl]oxymethyl]oxolan-3-yl] acetate.
| Compound Name | [(3R,4R,5R)-2,4-diacetyloxy-4-ethynyl-5-[[2-methyl-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]propan-2-yl]oxymethyl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 175133074 |
| Molecular Formula | C27H34N2O9 |
| Molecular Weight | 530.57 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | [(3R,4R,5R)-2,4-diacetyloxy-4-ethynyl-5-[[2-methyl-1-[4-(2-oxo-1,3-diazinan-1-yl)phenyl]propan-2-yl]oxymethyl]oxolan-3-yl] acetate |
| SMILES | C#C[C@@]1(OC(C)=O)[C@@H](COC(C)(C)Cc2ccc(N3CCCNC3=O)cc2)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C27H34N2O9/c1-7-27(38-19(4)32)22(37-24(36-18(3)31)23(27)35-17(2)30)16-34-26(5,6)15-20-9-11-21(12-10-20)29-14-8-13-28-25(29)33/h1,9-12,22-24H,8,13-16H2,2-6H3,(H,28,33)/t22-,23+,24?,27-/m1/s1 |
| InChIKey | BKYMLZLZXBOBSV-SCTDMFTHSA-N |
| XLogP | 2.10 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|