C6H9F2NO4 — CID 175133847
(2R)-2-amino-2-(difluoromethyl)pentanedioic acid (PubChem CID 175133847) has the molecular formula C6H9F2NO4 and a molecular weight of 197.14 g/mol. Its IUPAC name is (2R)-2-amino-2-(difluoromethyl)pentanedioic acid.
| Compound Name | (2R)-2-amino-2-(difluoromethyl)pentanedioic acid |
|---|---|
| PubChem CID | 175133847 |
| Molecular Formula | C6H9F2NO4 |
| Molecular Weight | 197.14 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | (2R)-2-amino-2-(difluoromethyl)pentanedioic acid |
| SMILES | N[C@](CCC(=O)O)(C(=O)O)C(F)F |
| InChI | InChI=1S/C6H9F2NO4/c7-4(8)6(9,5(12)13)2-1-3(10)11/h4H,1-2,9H2,(H,10,11)(H,12,13)/t6-/m0/s1 |
| InChIKey | KYIIZXRYIWJREO-LURJTMIESA-N |
| XLogP | -0.10 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |