C33H30F3N5O4S — CID 175134192
5,7,11-triamino-6-oxo-7-[4-phenoxy-2-(trifluoromethyl)phenyl]-N-(1-prop-2-enoylpiperidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 175134192) has the molecular formula C33H30F3N5O4S and a molecular weight of 649.70 g/mol. Its IUPAC name is 5,7,11-triamino-6-oxo-7-[4-phenoxy-2-(trifluoromethyl)phenyl]-N-(1-prop-2-enoylpiperidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 5,7,11-triamino-6-oxo-7-[4-phenoxy-2-(trifluoromethyl)phenyl]-N-(1-prop-2-enoylpiperidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 175134192 |
| Molecular Formula | C33H30F3N5O4S |
| Molecular Weight | 649.70 g/mol |
| Exact Mass | 649.20 |
| IUPAC Name | 5,7,11-triamino-6-oxo-7-[4-phenoxy-2-(trifluoromethyl)phenyl]-N-(1-prop-2-enoylpiperidin-3-yl)-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N1CCCC(NC(=O)c2sc3c(N)ccc4c3c2C(N)C(=O)C4(N)c2ccc(Oc3ccccc3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C33H30F3N5O4S/c1-2-24(42)41-14-6-7-17(16-41)40-31(44)29-26-25-21(12-13-23(37)28(25)46-29)32(39,30(43)27(26)38)20-11-10-19(15-22(20)33(34,35)36)45-18-8-4-3-5-9-18/h2-5,8-13,15,17,27H,1,6-7,14,16,37-39H2,(H,40,44) |
| InChIKey | XNAPNKRLVAOUKH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 153.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.70 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|