C22H21N3O5S — CID 175134341
methyl 5,7,11-triamino-7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate (PubChem CID 175134341) has the molecular formula C22H21N3O5S and a molecular weight of 439.49 g/mol. Its IUPAC name is methyl 5,7,11-triamino-7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate.
| Compound Name | methyl 5,7,11-triamino-7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
|---|---|
| PubChem CID | 175134341 |
| Molecular Formula | C22H21N3O5S |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | methyl 5,7,11-triamino-7-[4-(oxetan-3-yloxy)phenyl]-6-oxo-2-thiatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxylate |
| SMILES | COC(=O)c1sc2c(N)ccc3c2c1C(N)C(=O)C3(N)c1ccc(OC2COC2)cc1 |
| InChI | InChI=1S/C22H21N3O5S/c1-28-21(27)19-16-15-13(6-7-14(23)18(15)31-19)22(25,20(26)17(16)24)10-2-4-11(5-3-10)30-12-8-29-9-12/h2-7,12,17H,8-9,23-25H2,1H3 |
| InChIKey | GABPSCZPKFOYPJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 139.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|