About 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene
2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene (PubChem CID 175134482) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene |
| PubChem CID | 175134482 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene |
| SMILES | C=CC1=CCC(N=C=O)(N=C=O)C=C1 |
| InChI | InChI=1S/C10H8N2O2/c1-2-9-3-5-10(6-4-9,11-7-13)12-8-14/h2-5H,1,6H2 |
| InChIKey | CXAXSFHTMHMLKX-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene?
The IUPAC name of 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene (CID 175134482) is 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene.
What is the SMILES notation for 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene?
The canonical SMILES for 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene is C=CC1=CCC(N=C=O)(N=C=O)C=C1.
What is the InChIKey of 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene?
The InChIKey is CXAXSFHTMHMLKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O2/c1-2-9-3-5-10(6-4-9,11-7-13)12-8-14/h2-5H,1,6H2.
What are the key properties of 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene?
2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene has a molecular weight of 188.19 g/mol, XLogP of 1.43, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-5,5-diisocyanatocyclohexa-1,3-diene is sourced from PubChem (CID 175134482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).