C25H20F2N4O3 — CID 175135041
3-fluoro-2-[3-(4-fluoro-3-formylphenyl)-1H-pyrazol-5-yl]-N-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)benzamide (PubChem CID 175135041) has the molecular formula C25H20F2N4O3 and a molecular weight of 462.46 g/mol. Its IUPAC name is 3-fluoro-2-[3-(4-fluoro-3-formylphenyl)-1H-pyrazol-5-yl]-N-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)benzamide.
| Compound Name | 3-fluoro-2-[3-(4-fluoro-3-formylphenyl)-1H-pyrazol-5-yl]-N-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 175135041 |
| Molecular Formula | C25H20F2N4O3 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 3-fluoro-2-[3-(4-fluoro-3-formylphenyl)-1H-pyrazol-5-yl]-N-(1-hydroxy-3-pyridin-2-ylpropan-2-yl)benzamide |
| SMILES | O=Cc1cc(-c2cc(-c3c(F)cccc3C(=O)NC(CO)Cc3ccccn3)[nH]n2)ccc1F |
| InChI | InChI=1S/C25H20F2N4O3/c26-20-8-7-15(10-16(20)13-32)22-12-23(31-30-22)24-19(5-3-6-21(24)27)25(34)29-18(14-33)11-17-4-1-2-9-28-17/h1-10,12-13,18,33H,11,14H2,(H,29,34)(H,30,31) |
| InChIKey | SKBWVQQSOKORAW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|