C27H32O2Si — CID 175135089
2,2-dimethyl-6-(1,2,2-triphenylpropoxy)oxasilinane (PubChem CID 175135089) has the molecular formula C27H32O2Si and a molecular weight of 416.64 g/mol. Its IUPAC name is 2,2-dimethyl-6-(1,2,2-triphenylpropoxy)oxasilinane.
| Compound Name | 2,2-dimethyl-6-(1,2,2-triphenylpropoxy)oxasilinane |
|---|---|
| PubChem CID | 175135089 |
| Molecular Formula | C27H32O2Si |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | 2,2-dimethyl-6-(1,2,2-triphenylpropoxy)oxasilinane |
| SMILES | CC(c1ccccc1)(c1ccccc1)C(OC1CCC[Si](C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C27H32O2Si/c1-27(23-16-9-5-10-17-23,24-18-11-6-12-19-24)26(22-14-7-4-8-15-22)28-25-20-13-21-30(2,3)29-25/h4-12,14-19,25-26H,13,20-21H2,1-3H3 |
| InChIKey | LKJWDAYNHBWMON-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|