C12H28N2O4Si — CID 175136173
2,6-diamino-1-triethoxysilylhexan-1-one (PubChem CID 175136173) has the molecular formula C12H28N2O4Si and a molecular weight of 292.45 g/mol. Its IUPAC name is 2,6-diamino-1-triethoxysilylhexan-1-one.
| Compound Name | 2,6-diamino-1-triethoxysilylhexan-1-one |
|---|---|
| PubChem CID | 175136173 |
| Molecular Formula | C12H28N2O4Si |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 2,6-diamino-1-triethoxysilylhexan-1-one |
| SMILES | CCO[Si](OCC)(OCC)C(=O)C(N)CCCCN |
| InChI | InChI=1S/C12H28N2O4Si/c1-4-16-19(17-5-2,18-6-3)12(15)11(14)9-7-8-10-13/h11H,4-10,13-14H2,1-3H3 |
| InChIKey | WVZFKNDEFNNXJN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|