C32H37FN2O3 — CID 175137106
(E)-3-[4-[[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoic acid (PubChem CID 175137106) has the molecular formula C32H37FN2O3 and a molecular weight of 516.66 g/mol. Its IUPAC name is (E)-3-[4-[[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175137106 |
| Molecular Formula | C32H37FN2O3 |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | (E)-3-[4-[[3-fluoro-1-(oxan-2-yl)indazol-5-yl]-(3,3,5,5-tetramethylcyclohexylidene)methyl]phenyl]prop-2-enoic acid |
| SMILES | CC1(C)CC(=C(c2ccc(/C=C/C(=O)O)cc2)c2ccc3c(c2)c(F)nn3C2CCCCO2)CC(C)(C)C1 |
| InChI | InChI=1S/C32H37FN2O3/c1-31(2)18-24(19-32(3,4)20-31)29(22-11-8-21(9-12-22)10-15-28(36)37)23-13-14-26-25(17-23)30(33)34-35(26)27-7-5-6-16-38-27/h8-15,17,27H,5-7,16,18-20H2,1-4H3,(H,36,37)/b15-10+ |
| InChIKey | WUSRLUMSLWOCMV-XNTDXEJSSA-N |
| XLogP | 8.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|