About magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate
magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate (PubChem CID 175137318) has the molecular formula C10H10MgN2O6
and a molecular weight of 278.50 g/mol. Its IUPAC name is magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate.
Molecular Properties
| Compound Name | magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate |
| PubChem CID | 175137318 |
| Molecular Formula | C10H10MgN2O6 |
| Molecular Weight | 278.50 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)[O-].O=C([O-])c1cc(=O)[nH]c(=O)[nH]1.[Mg+2] |
| InChI | InChI=1S/C5H4N2O4.C5H8O2.Mg/c8-3-1-2(4(9)10)6-5(11)7-3;1-3-4(2)5(6)7;/h1H,(H,9,10)(H2,6,7,8,11);3H,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | KVHGCKWATVEMLE-UHFFFAOYSA-L |
| XLogP | -3.25 |
| TPSA | 145.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.50 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate?
The IUPAC name of magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate (CID 175137318) is magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate.
What is the SMILES notation for magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate?
The canonical SMILES for magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate is CC=C(C)C(=O)[O-].O=C([O-])c1cc(=O)[nH]c(=O)[nH]1.[Mg+2].
What is the InChIKey of magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate?
The InChIKey is KVHGCKWATVEMLE-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H4N2O4.C5H8O2.Mg/c8-3-1-2(4(9)10)6-5(11)7-3;1-3-4(2)5(6)7;/h1H,(H,9,10)(H2,6,7,8,11);3H,1-2H3,(H,6,7);/q;;+2/p-2.
What are the key properties of magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate?
magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate has a molecular weight of 278.50 g/mol, XLogP of -3.25, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2,4-dioxo-1H-pyrimidine-6-carboxylate;2-methylbut-2-enoate is sourced from PubChem (CID 175137318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).